Complement factor D-IN-2
Complement factor D-IN-2, a complement factor D inhibitor, is used in the study of autoimmune diseases. Complement factor D-IN-2 targets factor D and inhibits the complement cascade at an early and essential point in the alternative complement pathway. (Extracted from patent WO2015130838A1, compound 190)
| Supplier | BOC Sciences |
|---|---|
| Product # | 1903742-34-6 |
| Pricing | Inquire |
| Cas | 1903742-34-6 |
| Molecular Weight | 574.43 |
| Molecular Formula | C27H24BrN7O3 |
| Canonical SMILES | CC1=NC=C(C=N1)C2=CC3=C(C=C2)N(N=C3C(=O)C)CC(=O)N4C5CC5CC4C(=O)NC6=NC(=CC=C6)Br |