Levofloxacin-sodium
Levofloxacin ((-)-Ofloxacin) sodium is an orally active antibiotic and is active against both Gram-positive and Gram-negative bacteria. Levofloxacin sodium inhibits the DNA gyrase and topoisomerase IV. Levofloxacin sodium can be used for chronic periodontitis, airway inflammation and BK Viremia research. Levofloxacin sodium shows anti-orthopoxvirus activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 872606-49-0 |
| Pricing | Inquire |
| Cas | 872606-49-0 |
| Molecular Weight | 383.35 |
| Molecular Formula | C18H19FN3NaO4 |
| Canonical SMILES | CC1COC2=C3N1C=C(C(=O)C3=CC(=C2N4CCN(CC4)C)F)C(=O)[O-].[Na+] |