N4-Methyl-5-azacytidine
N4-Methyl-5-azacytidine is an esteemed chemical compound, finding profound significance within the biomedical realm owing to its immense potential in studying tumor progression. Exerting inhibitory effects on DNA methylation, this compound assumes a pivotal role within the domain of epigenetic investigation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 27826-76-2 |
| Pricing | Inquire |
| Cas | 27826-76-2 |
| Molecular Weight | 258.23 |
| Molecular Formula | C9H14N4O5 |
| Canonical SMILES | CNC1=NC(=O)N(C=N1)C2C(C(C(O2)CO)O)O |