1-(3, 4-Dichlorophenyl)-2-(1H-Imidazole-1-yl)-Ethanol
1-(3, 4-Dichlorophenyl)-2-(1H-Imidazole-1-yl)-Ethanol is a highly efficacious pharmaceutical substance, finding extensive application in studying diverse fungal infections, including systemic candidiasis is aspergillosis and dermatophytosis. Its mode of action revolves around impeding the biosynthesis of ergosterol is an indispensable constituent of fungal cellular membranes, consequently impeding cell integrity and arresting fungal proliferation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 27523-05-3 |
| Pricing | Inquire |
| Cas | 27523-05-3 |
| Molecular Weight | 257.12 |
| Molecular Formula | C11H10Cl2N2O |
| Canonical SMILES | C1=CC(=C(C=C1C(CN2C=CN=C2)O)Cl)Cl |