2-Amino-6-mercaptopurine-9-(2',3',5'-tri-O-acetyl-β-ribofuranosyl)purine
2-Amino-6-mercaptopurine-9-(2',3',5'-tri-O-acetyl-β-ribofuranosyl)purine exhibits remarkable efficacy as an antiviral and anti-inflammatory therapeutic agent devoted to combating viral afflictions like HIV and hepatitis. Additionally, this compound displays notable effectiveness in treating a diverse array of cancers, notably leukemia. By selectively targeting viral replication mechanisms and immune response pathways, this remarkable product effectively impedes virus propagation while mitigating inflammatory responses within the human body.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2946-36-3 |
| Pricing | Inquire |
| Cas | 2946-36-3 |
| Molecular Weight | 425.42 |
| Molecular Formula | C16H19N5O7S |
| Canonical SMILES | CC(=O)OCC1C(C(C(O1)N2C=NC3=C2NC(=NC3=S)N)OC(=O)C)OC(=O)C |