Benzyl 4-nitrophenyl carbonate
Benzyl 4-Nitrophenyl Carbonate is used as a reagent in the synthesis of Janus PEG-based dendrimers for use in combination therapy by controlled multi-drug loading and sequential release. Benzyl 4-Nitrophenyl Carbonate is also used as a reagent in the synthesis of Norfloxacin analogs which can exhibit antibacterial and antifungal activities under visible and UV light.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-006401 |
| Pricing | Inquire |
| Cas | 13795-24-9 |
| Molecular Weight | 273.24 |
| Molecular Formula | C14H11NO5 |
| Canonical SMILES | C1=CC=C(C=C1)COC(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |