LtaS-IN-1
LtaS-IN-1 is a potent small-molecule inhibitor that inhibits multidrug-resistant (MDR) E. faecium Lipoteichoic acid (LTA) synthesis by altering cell wall morphology. LtaS-IN-1 alone inhibits Enterococcus.spp 28 strains with varying MIC values ranging from 0.5 μg/mL to 64 μg/mL. LtaS-IN-1 combined antibiotics almost completely abolish the growth of multidrug-resistant E. faecium.
| Supplier | BOC Sciences |
|---|---|
| Product # | 877950-01-1 |
| Pricing | Inquire |
| Cas | 877950-01-1 |
| Molecular Weight | 427.41 |
| Molecular Formula | C24H17N3O5 |
| Canonical SMILES | C1=CC=C(C=C1)C2=NN=C(O2)NC(=O)COC(=O)CC3=COC4=C3C5=CC=CC=C5C=C4 |