2-Bromo-1-(3-fluoro-4-(4-methyl-1H-imidazol-1-yl)phenyl)ethanone
2-Bromo-1-(3-fluoro-4-(4-methyl-1H-imidazol-1-yl)phenyl)ethanone, a promising small molecule inhibitor, holds tremendous potential for use in biomedical research towards terminal selectivity of enzymes or pathologies. Nevertheless, the paucity of available information concerning this compound hampers its functional applications in diverse biological contexts.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2699-128594 |
| Pricing | Inquire |
| Cas | 1056050-24-8 |
| Molecular Weight | 297.12 |
| Molecular Formula | C12H10BrFN2O |
| Canonical SMILES | CC1=CN(C=N1)C2=C(C=C(C=C2)C(=O)CBr)F |