Esomeprazole potassium
Esomeprazole potassium is a proton pump inhibitor which acts as selective inhibiton of H+/K+-ATPase. With antiulcerative effects in vivo, it treats or ameliorates peptic ulcer or irritation of the gastrointestinal tract.
| Supplier | BOC Sciences |
|---|---|
| Product # | 161796-84-5 |
| Pricing | Inquire |
| Cas | 161796-84-5 |
| Molecular Weight | 383.51 |
| Molecular Formula | C17H18KN3O3S |
| Canonical SMILES | CC1=CN=C(C(=C1OC)C)CS(=O)C2=NC3=C([N-]2)C=CC(=C3)OC.[K+] |