1,2,3,4-Tetra-O-benzoyl-6-O-trityl-a-D-mannopyranose
1,2,3,4-Tetra-O-benzoyl-6-O-trityl-a-D-mannopyranose, an indispensable compound in the advancement of pharmaceutical agents, exhibits paramount significance in the synthesis of revolutionary therapeutic drugs encompassing a wide range of maladies such as cancer, diabetes, and infectious diseases. Profiting from its distinctive chemical attributes and architectural peculiarities, this compound assumes a pivotal role as a fundamental constituent in the creation of robust and efficacious medications.
| Supplier | BOC Sciences |
|---|---|
| Product # | 377074-45-8 |
| Pricing | Inquire |
| Cas | 377074-45-8 |
| Molecular Weight | 838.89 |
| Molecular Formula | C53H42O10 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)OC2C(OC(C(C2OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5)COC(C6=CC=CC=C6)(C7=CC=CC=C7)C8=CC=CC=C8 |