Omeprazole EP Impurity H
Omeprazole EP Impurity H is an impurity of Omeprazole. Omeprazole is a proton pump inhibitor used in the treatment of dyspepsia. It binds to the proton pump hydrogen-potassium adenosine triphosphatase (H+/K+ ATPase) and inhibits its activity and the parietal cell secretion of H+ ions into the gastric lumen.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0139-478369 |
| Pricing | Inquire |
| Cas | 863029-89-4 |
| Molecular Weight | 349.84 |
| Molecular Formula | C16H16ClN3O2S |
| Canonical SMILES | CC1=CN=C(C(=C1Cl)C)CS(=O)C2=NC3=C(N2)C=C(C=C3)OC |