3-N-(2,4-Dimethylbenzyl)-1-(5-O-DMT-3-O-nitrophenylsulphonyl-2-deoxy-b-D-lyxofuranosyl)thymidine
3-N-(2,4-Dimethylbenzyl)-1-(5-O-DMT-3-O-nitrophenylsulphonyl-2-deoxy-b-D-lyxofuranosyl)thymidine is an exceptional antiviral agent with remarkable potency. This biomedically employed compound exhibiting an astounding ability to combat viral infections, particularly those of retroviral origin. Employing a unique strategy, it hinders the replication of viral genetic material, thereby hampering the propagation of the virus.
Supplier | BOC Sciences |
---|---|
Product # | 290371-75-4 |
Pricing | Inquire |
Cas | 290371-75-4 |
Molecular Weight | 879.93 |
Molecular Formula | C46H45N3O13S |
Canonical SMILES | CC1=CN(C(=O)N(C1=O)CC2=C(C=C(C=C2)OC)OC)C3CC(C(O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)OS(=O)(=O)C7=CC=CC=C7[N+](=O)[O-] |