1-Methylguanosine
1-Methylguanosine is a methylated nucleoside. It is known that some modified, especially methylated, nucleosides originating from RNA degradation are excreted in abnormal levels in the urine of patients with malignant tumours. These nucleosides have been proposed as tumour markers. Their measurement could provide a non-invasive diagnostic method, help identify different cancers, and monitor any therapeutic effects.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2140-65-0 |
| Pricing | Inquire |
| Cas | 2140-65-0 |
| Molecular Weight | 297.27 |
| Molecular Formula | C11H15N5O5 |
| Canonical SMILES | CN1C(=O)C2=C(N=C1N)N(C=N2)C3C(C(C(O3)CO)O)O |