5'-O-(Dimethoxytrityl)-5-fluoro-2'-O-methyluridine
5'-O-(Dimethoxytrityl)-5-fluoro-2'-O-methyluridine is a remarkable nucleoside derivative (C40H44FN3O8) extensively employed in the biomedical sector for synthesizing nucleotide prodrugs and RNA molecules. Renowned for its distinct structural modifications, this compound showcases promising antiviral capabilities against specific viral infections, predominantly RNA viruses.
| Supplier | BOC Sciences |
|---|---|
| Product # | 869355-45-3 |
| Pricing | Inquire |
| Cas | 869355-45-3 |
| Molecular Weight | 578.59 |
| Molecular Formula | C31H31FN2O8 |
| Canonical SMILES | COC1C(C(OC1N2C=C(C(=O)NC2=O)F)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)O |