2-Cyano-3-methyl-2-butylbenzodithiolate
2-Cyano-3-methyl-2-butylbenzodithiolate, an organic compound exemplifying potentiality for pharmacological advancements, operates as a consequential intermediary in the synthesis of diverse medicinal and pharmaceutical concoctions. Specifically, it contributes to the formulation of therapeutics targeting cardiovascular maladies and neuropathological ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1823268-46-7 |
| Pricing | Inquire |
| Cas | 1823268-46-7 |
| Molecular Weight | 249.40 |
| Molecular Formula | C13H15NS2 |
| Canonical SMILES | CC(C)C(C)(C#N)SC(=S)C1=CC=CC=C1 |