Chondroitin sulfate C sodium salt
Chondroitin sulfate C sodium salt is a compound used in the research of joint disorders and osteoarthritis. It acts as a cartilage-building compound aiding in repair and regeneration. This compound is derived from sources such as fish or bovine cartilage.
| Supplier | BOC Sciences |
|---|---|
| Product # | 12678-07-8 |
| Pricing | Inquire |
| Cas | 12678-07-8 |
| Molecular Weight | 1390.1 |
| Molecular Formula | (C14H19NO14SNa2)n |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OC2C(C(C(OC2C(=O)[O-])OC3C(C(OC(C3O)COS(=O)(=O)[O-])OC4C(C(C(OC4C(=O)[O-])OC5C(C(OC(C5O)COS(=O)(=O)[O-])OC6C(C(C(OC6C(=O)[O-])O)O)O)NC(=O)C)O)O)NC(=O)C)O)O)COS(=O)(=O)[O-])O)O |