Dimethyl 2,4-diacetyl-3-(3-nitrophenyl)pentanedioate
Dimethyl 2,4-diacetyl-3-(3-nitrophenyl)pentanedioate is an intermediate in the synthesis of Methyl 2-Methyl-6-(3-nitrophenyl)-4-oxo-2-cyclohexene-1-carboxylate (M338310), a nicardipine impurity. Also, it is derived from Methyl Acetoacetate (O848425), which is a chemical reagent used in the synthesis of pharmaceuticals. It participates in the Biginelli reaction, forming molecules including dihydropyrimidinones.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB063195 |
| Pricing | Inquire |
| Cas | 89080-61-5 |
| Molecular Weight | 365.33 |
| Molecular Formula | C17H19NO8 |
| Canonical SMILES | CC(=O)C(C(C1=CC(=CC=C1)[N+](=O)[O-])C(C(=O)C)C(=O)OC)C(=O)OC |