A 425619
A 425619 is a potent and selective TRPV1 antagonist (IC50 = 3-9 nM) that inhibits TRPV1 activation by anandamide and N-arachidonoyl-dopamine. A 425619 exhibits an inhibitory effect against inflammatory, postoperative and osteoarthritic in vivo pain models.
| Supplier | BOC Sciences |
|---|---|
| Product # | 581809-67-8 |
| Pricing | Inquire |
| Cas | 581809-67-8 |
| Molecular Weight | 345.32 |
| Molecular Formula | C18H14F3N3O |
| Canonical SMILES | C1=CC2=C(C=CN=C2)C(=C1)NC(=O)NCC3=CC=C(C=C3)C(F)(F)F |