N6-Benzoyl-2',3'-isopropylideneadenosine
N6-Benzoyl-2',3'-isopropylideneadenosine, a highly valuable bioactive substance extensively employed in the field of biomedicine, exhibits remarkable antiviral characteristics. Its profound inhibitory effects on specific viruses, including HIV and hepatitis B, have been extensively acknowledged. Investigative studies propose that this compound operates by impeding viral enzymes, thereby impeding viral replication and impeding the advancement of associated ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 39947-04-1 |
| Pricing | Inquire |
| Cas | 39947-04-1 |
| Molecular Weight | 411.41 |
| Molecular Formula | C20H21N5O5 |
| Canonical SMILES | CC1(OC2C(OC(C2O1)N3C=NC4=C(N=CN=C43)NC(=O)C5=CC=CC=C5)CO)C |