Dimethyl lithospermate B
Dimethyl lithospermate B is an extract of Danshen, a traditional Chinese herbal remedy, which slows inactivation of INa, leading to increased inward current during the early phases of the action potential (AP). It is a highly potent natural antioxidant and antidiabetic polyphenol with unknown mode of action. It is effective in eliminating the arrhythmogenic substrate responsible for the Brugada syndrome and that it deserves further study as a pharmacological adjunct to implanted cardioverter/defibrillator usage. It slowed the inactivation kinetics of I(Na) by increasing the proportion of slowly inactivating component without inducing any persistent I(Na). It might be an excellent candidate for a Na(+) channel agonist.
Supplier | BOC Sciences |
---|---|
Product # | 875313-64-7 |
Pricing | Inquire |
Cas | 875313-64-7 |
Molecular Weight | 746.7 |
Molecular Formula | C38H34O16 |
Canonical SMILES | COC(=O)C(CC1=CC(=C(C=C1)O)O)OC(=O)C=CC2=C3C(C(OC3=C(C=C2)O)C4=CC(=C(C=C4)O)O)C(=O)OC(CC5=CC(=C(C=C5)O)O)C(=O)OC |