2',3',5'-Tri-O-benzoyl-2'-C-methyl-5-methoxyuridine
2',3',5'-Tri-O-benzoyl-2'-C-methyl-5-methoxyuridine, an essential chemical compound in biomedicine research, has been hailed for its remarkable potential antitumor activity and growth inhibitory effects on cancer cells. As scientists continue to explore its possibilities, this versatile compound may also hold the key to treating devastating viral infections like hepatitis C and HIV.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2072145-79-8 |
| Pricing | Inquire |
| Cas | 2072145-79-8 |
| Molecular Weight | 600.57 |
| Molecular Formula | C32H28N2O10 |
| Canonical SMILES | CC1(C(C(OC1N2C=C(C(=O)NC2=O)OC)COC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5 |