D-Raffinose undecaacetate
D-Raffinose undecaacetate, a remarkable biomedical product, holds immense potential in combating a multitude of diseases. Its pharmacological efficacy gravitates towards the management of diabetes, inflammation, as well as cancer. The distinctive chemical composition of D-Raffinose undecaacetate bestows it with significant anti-inflammatory attributes, optimizing blood glucose control, and showcasing commendable prospects in the realm of anticancer therapeutics.
| Supplier | BOC Sciences |
|---|---|
| Product # | 6462-12-0 |
| Pricing | Inquire |
| Cas | 6462-12-0 |
| Molecular Weight | 966.84 |
| Molecular Formula | C40H54O27 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3(C(C(C(O3)COC(=O)C)OC(=O)C)OC(=O)C)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |