Light Green SF Yellowish
| Supplier | CD Formulation |
|---|---|
| Product # | CDC10-0160 |
| CAS # | 225-906-5 |
| Pricing | 1 kg, Inquire for price |
| product1 | Cosmetic Ingredients |
| Molecular Formula | C37H34N2O9S3Na2 |
| Synonyms | Acid Green 5 |
| CAS Number | 5141-20-8 |
| Category | Cosmetic Color Additives |
| Grade | certified by the Biological Stain Commission |
| Purity | Dye content, ≥65% |
| Color | Red to Dark Purple |
| Physical State | Powder |
| Solubility | H2O: 1 mg/mL |
| Quality Level | 200.0 |
| Storage | Inert atmosphere,Room Temperature |
| Melting Point | 288 °C (dec.) (lit.) |
| Molecular Weight (g/mol) | 792.85 |
| MDL number | MFCD00012121 |
| NACRES | NA.47 |
| pH | 2.9 (10 g/L, H2O, 25℃) |
| SMILES | [Na+].[Na+].CCN(Cc1cccc(c1)S([O-])(=O)=O)c2ccc(cc2)\C(=C3\C=CC(\C=C3)=[N+](/CC)Cc4cccc(c4)S([O-])(=O)=O)c5ccc(cc5)S([O-])(=O)=O |
| InChI | 1S/C37H36N2O9S3.2Na/c1-3-38(25-27-7-5-9-35(23-27)50(43,44)45)32-17-11-29(12-18-32)37(31-15-21-34(22-16-31)49(40,41)42)30-13-19-33(20-14-30)39(4-2)26-28-8-6-10-36(24-28)51(46,47)48;;/h5-24H,3-4,25-26H2,1-2H3,(H2-,40,41,42,43,44,45,46,47,48);;/q;2*+1/p-2 |
| Hazard Codes | Xn |
| Safety Statements | 36/37-24/25 |
| WGK Germany | 2.0 |
| RTECS | BQ4900000 |
| HS Code | 32041200.0 |
| Image | 5141-20-8 |