2-(dibutylamino)-1-(2,7-dichloro-9H-fluoren-4-yl)ethanol HCl
2-(dibutylamino)-1-(2,7-dichloro-9H-fluoren-4-yl)ethanol HCl is a multifunctional biomedical compound exhibiting remarkable potential in studying and studying diverse diseases. With its pharmaceutical intermediate attributes, this compound warrants extensive exploration for its role in the synthesis of intricately designed drugs.
| Supplier | BOC Sciences |
|---|---|
| Product # | 53221-07-1 |
| Pricing | Inquire |
| Cas | 53221-07-1 |
| Molecular Weight | 442.849 |
| Molecular Formula | C23H30Cl3NO |
| Canonical SMILES | CCCCN(CCCC)CC(C1=C2C(=CC(=C1)Cl)CC3=C2C=CC(=C3)Cl)O.Cl |