5-Hydroxy-6-methoxy (S)-duloxetine
5-Hydroxy-6-methoxy (S)-duloxetine is a metabolite of (S)-duloxetine. It is formed from (S)-duloxetine via a 5- or 6-hydroxy duloxetine intermediate, which is formed by the cytochrome P450 (CYP) isoforms CYP1A2 and CYP2D6, and a catechol duloxetine intermediate.
| Supplier | BOC Sciences |
|---|---|
| Product # | 741693-79-8 |
| Pricing | Inquire |
| Cas | 741693-79-8 |
| Molecular Weight | 343.44 |
| Molecular Formula | C19H21NO3S |
| Canonical SMILES | CNCCC(C1=CC=CS1)OC2=CC=CC3=C2C=CC(=C3O)OC |