2,3,4,6-Tetra-O-acetyl-b-D-galactopyranosyl bromide
2,3,4,6-Tetra-O-acetyl-b-D-galactopyranosyl bromide is a useful reagent in the biomedical industry utilized for various purposes. It is commonly employed in the synthesis of carbohydrates and glycoconjugates for studying cell-surface interactions, such as carbohydrate-protein recognition. Additionally, it plays a crucial role in designing drugs to treat diseases related to abnormal carbohydrate metabolism or glycosylation, like cancer and genetic disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 19285-38-2 |
| Pricing | Inquire |
| Cas | 19285-38-2 |
| Molecular Weight | 411.20 |
| Molecular Formula | C14H19BrO9 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)Br)OC(=O)C)OC(=O)C)OC(=O)C |