Phosphatidylinositol, PI (wheat germ) sodium salt
Phosphatidylinositol, PI (wheat germ) sodium salt: A vital compound utilized in scientific investigations, functioning as a fundamental building block for cellular communication pathways associated with growth, differentiation, and viability. Furthermore, its therapeutic potential extends to targeting malignancies and neural dysfunctions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 84776-78-3 |
| Pricing | Inquire |
| Cas | 84776-78-3 |
| Molecular Weight | 881.05 |
| Molecular Formula | C45H78NaO13P |
| Canonical SMILES | CCCCCC=CCC=CCCCCCCCC(=O)OCC(COP(=O)([O-])OC1C(C(C(C(C1O)O)O)O)O)OC(=O)CCCCCCCC=CCC=CCCCCC.[Na+] |