T0901317
T0901317 is a potent and selective agonist for both LXR and FXR, with EC50 of ~50 nM and 5 μM, respectively. T0901317 induces apoptosis and inhibits the development of atherosclerosis in low-density lipoprotein (LDL) receptor-deficient mice.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0084-369166 |
| Pricing | Inquire |
| Cas | 293754-55-9 |
| Molecular Weight | 481.33 |
| Molecular Formula | C17H12F9NO3S |
| Canonical SMILES | C1=CC=C(C=C1)S(=O)(=O)N(CC(F)(F)F)C2=CC=C(C=C2)C(C(F)(F)F)(C(F)(F)F)O |