4'-C-Methyl-2-thiouridine
4'-C-Methyl-2-thiouridine, a highly potent biomedical compound, emerges as a revolutionary intervention for malignancies. Remarkably designed and purposefully crafted, this nucleoside analog holds the power to selectively thwart the growth of cancerous cells, exhibiting its profound antitumor prowess. Operating at the fundamental level, it intrudes upon the RNA of malignant cells, dismantling their intricate cellular mechanisms, culminating in an unprecedented hindrance to the relentless advancement of tumors. Experience the extraordinary potential of 4'-C-Methyl-2-thiouridine as it revolutionizes cancer treatment paradigms.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2305415-74-9 |
| Pricing | Inquire |
| Cas | 2305415-74-9 |
| Molecular Weight | 274.29 |
| Molecular Formula | C10H14N2O5S |
| Canonical SMILES | CC1(C(C(C(O1)N2C=CC(=O)NC2=S)O)O)CO |