2-Keto-3-(methyl-[13C,d1])-butyric-3,4,4,4-[d4] acid sodium salt
2-Keto-3-(methyl-[13C,d1])-butyric-3,4,4,4-[d4] acid sodium salt is intended for use as an internal standard for α-Keto Isovaleric Acid Sodium Salt. 2-Keto-3-(methyl-[13C,d1])-butyric-3,4,4,4-[d4] can be used in studies involving the selective isotopic unlabelling of proteins providing important residue-type information.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-005674 |
| Pricing | Inquire |
| Molecular Weight | 144.12 |
| Molecular Formula | [13C]C4H2D5NaO3 |
| Canonical SMILES | CC(C)C(=O)C(=O)[O-].[Na+] |