Bisphenol-A-[13C12]
Applications: A monomer used for policarbonate and epoxy resins; exhibits estrogenic activity.Dangerous Goods Info: Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-000089 |
| Pricing | Inquire |
| Cas | 263261-65-0 |
| Molecular Weight | 240.20 |
| Molecular Formula | C3[13C]12H16O2 |
| Canonical SMILES | CC(C)(C1=CC=C(C=C1)O)C2=CC=C(C=C2)O |