[Des-octanoyl]-Ghrelin (human)
[Des-octanoyl]-Ghrelin (human) is the major circulating isoform of ghrelin that does not bind to the ghrelin receptor (GHS-R1a), nor induce growth hormone release. It exhibits negative inotropic effects in papillary muscle and cardioprotective activity. It also displays an inhibitory effect on cell proliferation in breast and prostate cancer cell lines.
| Supplier | BOC Sciences |
|---|---|
| Product # | 313951-59-6 |
| Pricing | Inquire |
| Cas | 313951-59-6 |
| Molecular Weight | 3244.51 |
| Molecular Formula | C141H235N47O41 |
| Canonical SMILES | CC(C)CC(C(=O)NC(CCC(=O)N)C(=O)N1CCCC1C(=O)NC(CCCNC(=N)N)C(=O)O)NC(=O)C(CCCCN)NC(=O)C(C)NC(=O)C2CCCN2C(=O)C3CCCN3C(=O)C(CCCCN)NC(=O)C(CCCCN)NC(=O)C(CO)NC(=O)C(CCC(=O)O)NC(=O)C(CCCCN)NC(=O)C(CCCNC(=N)N)NC(=O)C(CCC(=O)N)NC(=O)C(CCC(=O)N)NC(=O)C(C(C)C)NC(=O)C(CCCNC(=N)N)NC(=O)C(CCC(=O)N)NC(=O)C(CC4=CNC=N4)NC(=O)C(CCC(=O)O)NC(=O)C5CCCN5C(=O)C(CO)NC(=O)C(CC(C)C)NC(=O)C(CC6=CC=CC=C6)NC(=O)C(CO)NC(=O)C(CO)NC(=O)CN |