9-(β-L-ribofuranosyl)-6-chloropurine
9-(β-L-ribofuranosyl)-6-chloropurine is an indispensable compound extensively employed in the biomedical sector, exhibiting pivotal significance in the research of diverse ailments. Notably, within the realm of antiviral pharmaceuticals, this compound assumes a critical position, especially in research of herpes and hepatitis B. The distinctive molecular architecture and characteristic traits thereof render it an indispensable constituent for formulating efficacious remedial strategies warranting optimal outcomes in attenuating these notorious viral afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 415705-32-7 |
| Pricing | Inquire |
| Cas | 415705-32-7 |
| Molecular Weight | 286.674 |
| Molecular Formula | C10H11ClN4O4 |
| Canonical SMILES | C1=NC2=C(C(=N1)Cl)N=CN2C3C(C(C(O3)CO)O)O |