4-Methoxyphenyl 2-azido-3,6-di-O-benzyl-2-deoxy-b-D-glucopyranoside
4-Methoxyphenyl 2-azido-3,6-di-O-benzyl-2-deoxy-b-D-glucopyranoside is a remarkable compound within the biomedical field. Its strategic implementation as a precursor for drug research and development enables efficacious researchs for cancer, viral infections is and inflammatory disorders. Distinctive structural attributes amplify its potential, rendering it an invaluable resource for revolutionary developments in compound.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1272755-25-5 |
| Pricing | Inquire |
| Cas | 1272755-25-5 |
| Molecular Weight | 491.54 |
| Molecular Formula | C27H29N3O6 |
| Canonical SMILES | COC1=CC=C(C=C1)OC2C(C(C(C(O2)COCC3=CC=CC=C3)O)OCC4=CC=CC=C4)N=[N+]=[N-] |