2'-Amino-2'-deoxy-b-D-arabino-5-methyluridine
2'-Amino-2'-deoxy-b-D-arabino-5-methyluridine is a nucleoside analog with the ability to inhibit viral reverse transcriptase and DNA polymerase activities. It has been used in the development of antiviral drugs for the treatment of HIV and hepatitis B and C infections. Additionally, it has been studied for its potential use in cancer therapy due to its ability to induce apoptosis in cancer cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 135304-48-2 |
| Pricing | Inquire |
| Cas | 135304-48-2 |
| Molecular Weight | 257.24 |
| Molecular Formula | C10H15N3O5 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C(C(C(O2)CO)O)N |