Mono-methyl terephthalate
Mono-methyl terephthalate is used in the synthesis of Hepatits C antiviral activity. Also used in the design and preparation of benzamide derivatives as BRAFV600E inhibitors, which if mutated, can influence malignancies and melanomas.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1679-64-7 |
| Pricing | Inquire |
| Cas | 1679-64-7 |
| Molecular Weight | 180.16 |
| Molecular Formula | C9H8O4 |
| Canonical SMILES | COC(=O)C1=CC=C(C=C1)C(=O)O |