5'-O-DMT-N6-Acetyl-2'-deoxyadenosine 3'-CE phosphoramidite
5'-O-DMT-N6-Acetyl-2'-deoxyadenosine 3'-CE phosphoramidite is a key component for the synthesis of modified oligonucleotides, which have applications in gene therapy and antiviral drug development. This phosphoramidite can be used to introduce an N6-acetyldeoxyadenosine modification to oligonucleotide strands, which has been shown to enhance their cellular uptake and improve their stability towards nucleases. It is also useful for generating oligonucleotides with 3'-CE modifications, which can improve their binding and selectivity towards complementary RNA targets.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1027734-01-5 |
| Pricing | Inquire |
| Cas | 1027734-01-5 |
| Molecular Weight | 795.86 |
| Molecular Formula | C42H50N7O7P |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1CC(OC1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)N5C=NC6=C(N=CN=C65)NC(=O)C |