3-Methyl-2-((1-(3-(trimethylammonio)propyl)pyridin-4(1H)-ylidene)methyl)benzo[d]oxazol-3-ium iodide
3-Methyl-2-((1-(3-(trimethylammonio)propyl)pyridin-4(1H)-ylidene)methyl)benzo[d]oxazol-3-ium iodide is a biomedical compound that presents an intricate chemical structure. This product is employed in combating diverse afflictions, exhibiting remarkable potency in eradicating drug-resistant bacteria and fungi. Additionally, it manifests potential inhibitory effects against specific enzymes implicated in the advancement of diseases. Its multifaceted functionality and inherent properties render it a highly promising candidate for therapeutic exploitation in the realm of biomedicine.
| Supplier | BOC Sciences |
|---|---|
| Product # | 157199-56-9 |
| Pricing | Inquire |
| Cas | 157199-56-9 |
| Molecular Weight | 579.26 |
| Molecular Formula | C20H27I2N3O |
| Canonical SMILES | CN1C2=CC=CC=C2OC1=CC3=CC=[N+](C=C3)CCC[N+](C)(C)C.[I-].[I-] |