5-(1-Propynyl)-2'-deoxyuridine
5-(1-Propynyl)-2'-deoxyuridine, a powerful antiviral agent employed in the field of biomedical sciences, showcases exceptional therapeutic capabilities against Herpes simplex virus and Varicella zoster virus. Through inhibition of viral DNA synthesis, this nucleoside analogue exhibits utmost efficacy in combating herpes infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 84558-94-1 |
| Pricing | Inquire |
| Cas | 84558-94-1 |
| Molecular Weight | 266.25 |
| Molecular Formula | C12H14N2O5 |
| Canonical SMILES | CC#CC1=CN(C(=O)NC1=O)C2CC(C(O2)CO)O |