Methyl b-D-mannopyranoside isopropylate
Methyl b-D-mannopyranoside isopropylate is a biomedical product commonly used in research and drug development. It is known for its ability to mimic the structure of specific sugar molecules found in the body. This compound is utilized in studies related to glycosylation, carbohydrate metabolism, and drug design targeting diseases such as cancer and diabetes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 911673-07-9 |
| Pricing | Inquire |
| Cas | 911673-07-9 |
| Molecular Weight | 254.28 |
| Molecular Formula | C7H14O6.C3H8O |
| Canonical SMILES | CC(C)O.COC1C(C(C(C(O1)CO)O)O)O |