6-O-(p-Hydroxybenzoyl)glucose
6-O-(p-Hydroxybenzoyl)glucose is a natural compound deftly navigating the intricate pathways of cancer cells is arresting their expansion and halting their pernicious proliferation. Moreover, boasting noteworthy antioxidant attributes, it tantalizingly teases the prophylactic envelope, offering a glimmer of hope for those grappling with inflammation-linked maladies.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP4354 |
| Pricing | Inquire |
| Cas | 202337-44-8 |
| Molecular Weight | 300.265 |
| Molecular Formula | C13H16O8 |
| Canonical SMILES | C1=CC(=CC=C1C(=O)OCC(C(C(C(C=O)O)O)O)O)O |