Tafamidis-[d3]
Tafamidis-[d3] is deuterium labelled Tafamidis. Tafamidis is a potent and selective transthyretin (TTR) stabilizer, showing comparable potency and efficacy to the mutumant homotetramers V30M-TTR, V122I-TTR and wild type WT-TTR, with EC50s of 2.7-3.2 μM. Tafamidis inhibits amyloidogenesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-014826 |
| Pricing | Inquire |
| Molecular Weight | 311.13 |
| Molecular Formula | C14H4D3Cl2NO3 |
| Canonical SMILES | C1=CC2=C(C=C1C(=O)O)OC(=N2)C3=CC(=CC(=C3)Cl)Cl |