6-Chloro-2-iodopurine riboside
6-Chloro-2-iodopurine riboside, a highly potent biomedicine, exhibits noteworthy implications in addressing diverse medical conditions. Functioning as an efficacious antiviral and antineoplastic agent, it specifically targets pivotal enzymes and effectively obstructs their functionality. By virtue of its distinct molecular configuration, it showcases encouraging outcomes in combating viral infections, including herpes and influenza, as well as certain malignancies. The intricate workings of this compound render it an invaluable asset within the biomedical domain.
| Supplier | BOC Sciences |
|---|---|
| Product # | 313477-85-9 |
| Pricing | Inquire |
| Cas | 313477-85-9 |
| Molecular Weight | 412.57 |
| Molecular Formula | C10H10ClIN4O4 |
| Canonical SMILES | C1=NC2=C(N1C3C(C(C(O3)CO)O)O)N=C(N=C2Cl)I |