2,3-Dihydro-6-methylginkgetin
2,3-Dihydro-6-methylginkgetin is a bioactive constituent originating from Ginkgo biloba, showcasing commendable potential in studying prevalent neurodegenerative ailments like Alzheimer's and Parkinson's. This formidable natural compound exudes profound antioxidative attributes in the research of cardiovascular disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP2390 |
| Pricing | Inquire |
| Cas | 1013649-09-6 |
| Molecular Weight | 582.55 |
| Molecular Formula | C33H26O10 |
| Canonical SMILES | CC1=C(C=C2C(=C1O)C(=O)CC(O2)C3=CC(=C(C=C3)OC)C4=C(C=C(C5=C4OC(=CC5=O)C6=CC=C(C=C6)O)O)O)OC |