Roseorubicin B
It is produced by the strain of Actinomyces roseoviolaceus A529. It has anti-gram-positive bacteria and mycobacterium effect, and Roseorubicin A has stronger antibacterial effect than B. It also inhibits leukaemia L1210 with IC50 of 0.06 μg/mL.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02210 |
| Pricing | Inquire |
| Cas | 70559-01-2 |
| Molecular Weight | 684.77 |
| Molecular Formula | C36H48N2O11 |
| Canonical SMILES | CCC1(CCC2=C(C1OC3CC(C(C(O3)C)OC4CC(C(C(O4)C)O)N(C)C)N(C)C)C(=C5C(=C2O)C(=O)C6=C(C5=O)C=CC=C6O)O)O |