4-Chloro-6-iodoquinazoline
4-Chloro-6-iodoquinazoline is used as a chemical reagent in the synthesis of pharmaceutical drugs targeting various diseases including cancer and inflammatory disorders. It acts as a building block for creating novel compounds with potential therapeutic applications.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP3165 |
| Pricing | Inquire |
| Cas | 98556-31-1 |
| Molecular Weight | 290.49 |
| Molecular Formula | C8H4ClIN2 |
| Canonical SMILES | C1=CC2=C(C=C1I)C(=NC=N2)Cl |