5'-O-DMT-2'-O-propynyluridine 3'-CE phosphoramidite
5'-O-DMT-2'-O-propynyluridine 3'-CE phosphoramidite, a vital component in biomedicine, finds extensive application in the synthesis of altered RNA oligonucleotides. Its inclusion as a fundamental constituent allows for the creation of diverse modified RNA sequences that effectively target particular genes or diseases. Distinctively adorned with a pattern of modifications, this compound empowers researchers in the advancement of sophisticated therapeutics to combat an array of conditions, encompassing malignant neoplasms and viral afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 171486-62-7 |
| Pricing | Inquire |
| Cas | 171486-62-7 |
| Molecular Weight | 784.83 |
| Molecular Formula | C42H49N4O9P |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1C(OC(C1OCC#C)N2C=CC(=O)NC2=O)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC |