Salazinic acid
Salazinic acid is a depsidone lichen metabolite originally isolated from P. sulcata. It is active against B. cereus, B. subtilis, S. aureus, P. aeruginosa, S. typhimurium, C. albicans, and A. niger in vitro (MICs = 3.9-30.8 mM). Salazinic acid is also cytotoxic to MM98, A431, and HaCaT cells in crystal violet (EC50s = 159, 2,870, and 48 μM, respectively) and neutral red uptake assays (EC50s = 1,925, 1,913, and 907 μM, respectively).
| Supplier | BOC Sciences |
|---|---|
| Product # | 521-39-1 |
| Pricing | Inquire |
| Cas | 521-39-1 |
| Molecular Weight | 388.28 |
| Molecular Formula | C18H12O10 |
| Canonical SMILES | CC1=CC(=C(C2=C1C(=O)OC3=C(O2)C4=C(C(=C3CO)O)C(=O)OC4O)C=O)O |