AR-7
AR-7, also known as Atypical retinoid 7, was developed as a highly potent and selective enhancer of the chaperone-mediated autophagy (CMA) through antagonizing RARα. AR-7 was suggested to be used at 5-20 µM final concentration in vitro and in cellular assays.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2693-007831 |
| Pricing | Inquire |
| Cas | 80306-38-3 |
| Molecular Weight | 257.71 |
| Molecular Formula | C15H12ClNO |
| Canonical SMILES | CC1=CC=C(C2=NC3=CC=C(Cl)C=C3OC2)C=C1 |