6-Methyl-8-quinoxalinesulfonyl Chloride
6-Methyl-8-quinoxalinesulfonyl Chloride similar to other quinoxalinesulfonyl compounds can be used in the preparation of 8-mercaptoquinoline derivatives as well as various sulfonamides. In addition, the compound itself has the potential to inhibit tyrosine kinases.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB059497 |
| Pricing | Inquire |
| Cas | 21863-51-4 |
| Molecular Weight | 241.69 |
| Molecular Formula | C10H8ClNO2S |
| Canonical SMILES | CC1=CC2=C(C(=C1)S(=O)(=O)Cl)N=CC=C2 |